C15H14ClN5 — CID 65028737
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 65028737) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 65028737 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Cc1nnc2c(NC3c4ccccc4CC3Cl)nccn12 |
| InChI | InChI=1S/C15H14ClN5/c1-9-19-20-15-14(17-6-7-21(9)15)18-13-11-5-3-2-4-10(11)8-12(13)16/h2-7,12-13H,8H2,1H3,(H,17,18) |
| InChIKey | TUHDZCRRTHLQBW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|