C11H10ClN3S — CID 65277345
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 65277345) has the molecular formula C11H10ClN3S and a molecular weight of 251.74 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65277345 |
| Molecular Formula | C11H10ClN3S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | ClC1Cc2ccccc2C1Nc1ncns1 |
| InChI | InChI=1S/C11H10ClN3S/c12-9-5-7-3-1-2-4-8(7)10(9)15-11-13-6-14-16-11/h1-4,6,9-10H,5H2,(H,13,14,15) |
| InChIKey | PLEFLCHTDYPMAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|