C14H15ClN2S — CID 65028482
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-ethyl-1,3-thiazol-2-amine (PubChem CID 65028482) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-ethyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-ethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65028482 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-ethyl-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NC2c3ccccc3CC2Cl)n1 |
| InChI | InChI=1S/C14H15ClN2S/c1-2-10-8-18-14(16-10)17-13-11-6-4-3-5-9(11)7-12(13)15/h3-6,8,12-13H,2,7H2,1H3,(H,16,17) |
| InChIKey | SNOGGDDWUWNJCO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|