C12H10BrNO — CID 65041798
2-(3-bromofuran-2-yl)-2,3-dihydro-1H-indole (PubChem CID 65041798) has the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. Its IUPAC name is 2-(3-bromofuran-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 2-(3-bromofuran-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 65041798 |
| Molecular Formula | C12H10BrNO |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 2-(3-bromofuran-2-yl)-2,3-dihydro-1H-indole |
| SMILES | Brc1ccoc1C1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H10BrNO/c13-9-5-6-15-12(9)11-7-8-3-1-2-4-10(8)14-11/h1-6,11,14H,7H2 |
| InChIKey | KTKJVBKOZHBAEI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |