C10H15NO4S3 — CID 65094322
2-(3-ethylsulfonylpropylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 65094322) has the molecular formula C10H15NO4S3 and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-ethylsulfonylpropylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 65094322 |
| Molecular Formula | C10H15NO4S3 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(3-ethylsulfonylpropylsulfanyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCS(=O)(=O)CCCSc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C10H15NO4S3/c1-3-18(14,15)6-4-5-16-10-11-7(2)8(17-10)9(12)13/h3-6H2,1-2H3,(H,12,13) |
| InChIKey | TUZKKJBWYMUYAW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|