C15H12N2OS2 — CID 651443
N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide (PubChem CID 651443) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 651443 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H12N2OS2/c18-14(9-12-7-4-8-19-12)17-15-16-13(10-20-15)11-5-2-1-3-6-11/h1-8,10H,9H2,(H,16,17,18) |
| InChIKey | FAPGLCHVGWEYQH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|