C7H10N4OS — CID 65211838
(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl carbamimidothioate (PubChem CID 65211838) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl carbamimidothioate.
| Compound Name | (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 65211838 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1nc(C2CC2)no1 |
| InChI | InChI=1S/C7H10N4OS/c8-7(9)13-3-5-10-6(11-12-5)4-1-2-4/h4H,1-3H2,(H3,8,9) |
| InChIKey | CIQHOMMHINNBTD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|