C10H14N4O3S2 — CID 65214119
N-[[4-[(carbamothioylamino)sulfamoyl]phenyl]methyl]acetamide (PubChem CID 65214119) has the molecular formula C10H14N4O3S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-[[4-[(carbamothioylamino)sulfamoyl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[(carbamothioylamino)sulfamoyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 65214119 |
| Molecular Formula | C10H14N4O3S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[[4-[(carbamothioylamino)sulfamoyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NNC(N)=S)cc1 |
| InChI | InChI=1S/C10H14N4O3S2/c1-7(15)12-6-8-2-4-9(5-3-8)19(16,17)14-13-10(11)18/h2-5,14H,6H2,1H3,(H,12,15)(H3,11,13,18) |
| InChIKey | HTJSWTGNSUYXNH-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|