C6H13N3O3S2 — CID 65214617
[(2-methyl-2-methylsulfonylpropanoyl)amino]thiourea (PubChem CID 65214617) has the molecular formula C6H13N3O3S2 and a molecular weight of 239.32 g/mol. Its IUPAC name is [(2-methyl-2-methylsulfonylpropanoyl)amino]thiourea.
| Compound Name | [(2-methyl-2-methylsulfonylpropanoyl)amino]thiourea |
|---|---|
| PubChem CID | 65214617 |
| Molecular Formula | C6H13N3O3S2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | [(2-methyl-2-methylsulfonylpropanoyl)amino]thiourea |
| SMILES | CC(C)(C(=O)NNC(N)=S)S(C)(=O)=O |
| InChI | InChI=1S/C6H13N3O3S2/c1-6(2,14(3,11)12)4(10)8-9-5(7)13/h1-3H3,(H,8,10)(H3,7,9,13) |
| InChIKey | AWXXDXNYVFYANL-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|