C8H17NO5S — CID 79676240
N-(2-methoxyethoxy)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 79676240) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(2-methoxyethoxy)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 79676240 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-(2-methoxyethoxy)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | COCCONC(=O)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C8H17NO5S/c1-8(2,15(4,11)12)7(10)9-14-6-5-13-3/h5-6H2,1-4H3,(H,9,10) |
| InChIKey | XCWHXOQGESNIGH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|