C10H13N3O5 — CID 65219989
2-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]methyl]butanoic acid (PubChem CID 65219989) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]methyl]butanoic acid.
| Compound Name | 2-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 65219989 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]methyl]butanoic acid |
| SMILES | CCC(CNC(=O)c1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13N3O5/c1-2-5(9(16)17)4-11-8(15)6-3-7(14)13-10(18)12-6/h3,5H,2,4H2,1H3,(H,11,15)(H,16,17)(H2,12,13,14,18) |
| InChIKey | RDJPMFFJWOFRTB-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |