C15H14N3O5- — CID 7037985
(3R)-4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-3-phenylbutanoate (PubChem CID 7037985) has the molecular formula C15H14N3O5- and a molecular weight of 316.29 g/mol. Its IUPAC name is (3R)-4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-3-phenylbutanoate.
| Compound Name | (3R)-4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-3-phenylbutanoate |
|---|---|
| PubChem CID | 7037985 |
| Molecular Formula | C15H14N3O5- |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (3R)-4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-3-phenylbutanoate |
| SMILES | O=C([O-])C[C@@H](CNC(=O)c1cc(=O)[nH]c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O5/c19-12-7-11(17-15(23)18-12)14(22)16-8-10(6-13(20)21)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2,(H,16,22)(H,20,21)(H2,17,18,19,23)/p-1/t10-/m0/s1 |
| InChIKey | FYRVHIGVUQJEGI-JTQLQIEISA-M |
| XLogP | -1.28 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |