C15H26N2O4 — CID 65301636
ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(ethylamino)-2-methylbutanoate (PubChem CID 65301636) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(ethylamino)-2-methylbutanoate.
| Compound Name | ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(ethylamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 65301636 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ethyl 4-(3,3-dimethyl-2,5-dioxopyrrolidin-1-yl)-2-(ethylamino)-2-methylbutanoate |
| SMILES | CCNC(C)(CCN1C(=O)CC(C)(C)C1=O)C(=O)OCC |
| InChI | InChI=1S/C15H26N2O4/c1-6-16-15(5,13(20)21-7-2)8-9-17-11(18)10-14(3,4)12(17)19/h16H,6-10H2,1-5H3 |
| InChIKey | AREOAFQTHPZOLJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|