C14H16N2O4S — CID 65363814
4-[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-1,4-diazepan-2-one (PubChem CID 65363814) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-1,4-diazepan-2-one.
| Compound Name | 4-[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65363814 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[2-(3-hydroxyprop-1-ynyl)phenyl]sulfonyl-1,4-diazepan-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2C#CCO)CCCN1 |
| InChI | InChI=1S/C14H16N2O4S/c17-10-3-6-12-5-1-2-7-13(12)21(19,20)16-9-4-8-15-14(18)11-16/h1-2,5,7,17H,4,8-11H2,(H,15,18) |
| InChIKey | FJUHTVMKOSUSHW-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|