About 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine
2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 65419422) has the molecular formula C16H20N2S
and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine.
Molecular Properties
| Compound Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine |
| PubChem CID | 65419422 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | Cc1ncsc1CCC1(N)CCc2ccccc2C1 |
| InChI | InChI=1S/C16H20N2S/c1-12-15(19-11-18-12)7-9-16(17)8-6-13-4-2-3-5-14(13)10-16/h2-5,11H,6-10,17H2,1H3 |
| InChIKey | REYUHEOIBRTZRB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine?
The IUPAC name of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine (CID 65419422) is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine.
What is the SMILES notation for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine?
The canonical SMILES for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine is Cc1ncsc1CCC1(N)CCc2ccccc2C1.
What is the InChIKey of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine?
The InChIKey is REYUHEOIBRTZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2S/c1-12-15(19-11-18-12)7-9-16(17)8-6-13-4-2-3-5-14(13)10-16/h2-5,11H,6-10,17H2,1H3.
What are the key properties of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine?
2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine has a molecular weight of 272.42 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3,4-dihydro-1H-naphthalen-2-amine is sourced from PubChem (CID 65419422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).