C9H11N5O3 — CID 65441440
methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate (PubChem CID 65441440) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate |
|---|---|
| PubChem CID | 65441440 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate |
| SMILES | COC(=O)C(Cn1cnc(C#N)n1)NC(C)=O |
| InChI | InChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15) |
| InChIKey | SEAWTQYGMIYBNS-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |