About methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate
methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate (PubChem CID 65441440) has the molecular formula C9H11N5O3
and a molecular weight of 237.22 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate |
| PubChem CID | 65441440 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate |
| SMILES | COC(=O)C(Cn1cnc(C#N)n1)NC(C)=O |
| InChI | InChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15) |
| InChIKey | SEAWTQYGMIYBNS-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The IUPAC name of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate (CID 65441440) is methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate is COC(=O)C(Cn1cnc(C#N)n1)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The InChIKey is SEAWTQYGMIYBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15).
What are the key properties of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate has a molecular weight of 237.22 g/mol, XLogP of -1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 65441440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).