methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate

C9H11N5O3 — CID 65441440

IUPACmethyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate
SMILESCOC(=O)C(Cn1cnc(C#N)n1)NC(C)=O
InChIInChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15)
InChIKeySEAWTQYGMIYBNS-UHFFFAOYSA-N
MW237.22 g/mol
LogP-1.17
Rot. Bonds4

About methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate

methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate (PubChem CID 65441440) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate
PubChem CID65441440
Molecular FormulaC9H11N5O3
Molecular Weight237.22 g/mol
Exact Mass237.09
IUPAC Namemethyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate
SMILESCOC(=O)C(Cn1cnc(C#N)n1)NC(C)=O
InChIInChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15)
InChIKeySEAWTQYGMIYBNS-UHFFFAOYSA-N
XLogP-1.17
TPSA109.90 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.22
LogP ≤ 5-1.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The IUPAC name of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate (CID 65441440) is methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate.
What is the SMILES notation for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The canonical SMILES for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate is COC(=O)C(Cn1cnc(C#N)n1)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
The InChIKey is SEAWTQYGMIYBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3/c1-6(15)12-7(9(16)17-2)4-14-5-11-8(3-10)13-14/h5,7H,4H2,1-2H3,(H,12,15).
What are the key properties of methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate?
methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate has a molecular weight of 237.22 g/mol, XLogP of -1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(3-cyano-1,2,4-triazol-1-yl)propanoate is sourced from PubChem (CID 65441440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).