C11H15BrN4O4 — CID 161036699
ethyl 2-bromoacetate;ethyl 2-(3-cyano-1,2,4-triazol-1-yl)acetate (PubChem CID 161036699) has the molecular formula C11H15BrN4O4 and a molecular weight of 347.17 g/mol. Its IUPAC name is ethyl 2-bromoacetate;ethyl 2-(3-cyano-1,2,4-triazol-1-yl)acetate.
| Compound Name | ethyl 2-bromoacetate;ethyl 2-(3-cyano-1,2,4-triazol-1-yl)acetate |
|---|---|
| PubChem CID | 161036699 |
| Molecular Formula | C11H15BrN4O4 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | ethyl 2-bromoacetate;ethyl 2-(3-cyano-1,2,4-triazol-1-yl)acetate |
| SMILES | CCOC(=O)CBr.CCOC(=O)Cn1cnc(C#N)n1 |
| InChI | InChI=1S/C7H8N4O2.C4H7BrO2/c1-2-13-7(12)4-11-5-9-6(3-8)10-11;1-2-7-4(6)3-5/h5H,2,4H2,1H3;2-3H2,1H3 |
| InChIKey | UAIOOMXCZLDHIE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 107.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|