C14H18O2 — CID 65456542
5-but-3-en-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 65456542) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-but-3-en-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-but-3-en-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 65456542 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-but-3-en-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | C=CC(C)Oc1cccc2c1CCCC2O |
| InChI | InChI=1S/C14H18O2/c1-3-10(2)16-14-9-5-6-11-12(14)7-4-8-13(11)15/h3,5-6,9-10,13,15H,1,4,7-8H2,2H3 |
| InChIKey | IBNGUORHKOKXHY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|