About 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide
3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide (PubChem CID 65468682) has the molecular formula C14H16BrN3O2S
and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide |
| PubChem CID | 65468682 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide |
| SMILES | Cc1cc(Br)cc(C)c1Nc1cc(N)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H16BrN3O2S/c1-8-3-10(15)4-9(2)14(8)18-12-5-11(16)6-13(7-12)21(17,19)20/h3-7,18H,16H2,1-2H3,(H2,17,19,20) |
| InChIKey | CPLBAWJDKHAQCB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide?
The IUPAC name of 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide (CID 65468682) is 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide.
What is the SMILES notation for 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide?
The canonical SMILES for 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide is Cc1cc(Br)cc(C)c1Nc1cc(N)cc(S(N)(=O)=O)c1.
What is the InChIKey of 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide?
The InChIKey is CPLBAWJDKHAQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BrN3O2S/c1-8-3-10(15)4-9(2)14(8)18-12-5-11(16)6-13(7-12)21(17,19)20/h3-7,18H,16H2,1-2H3,(H2,17,19,20).
What are the key properties of 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide?
3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide has a molecular weight of 370.27 g/mol, XLogP of 3.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(4-bromo-2,6-dimethylanilino)benzenesulfonamide is sourced from PubChem (CID 65468682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).