C10H11Cl2N3O2S — CID 65474474
2-[2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]ethoxy]ethanol (PubChem CID 65474474) has the molecular formula C10H11Cl2N3O2S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-[2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 65474474 |
| Molecular Formula | C10H11Cl2N3O2S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-[2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]ethoxy]ethanol |
| SMILES | OCCOCCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C10H11Cl2N3O2S/c11-6-5-7(12)9-10(15-18-14-9)8(6)13-1-3-17-4-2-16/h5,13,16H,1-4H2 |
| InChIKey | WITQQGAGEZAPQG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|