C13H15BrN2O2S2 — CID 65481998
4-(bromomethyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 65481998) has the molecular formula C13H15BrN2O2S2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 4-(bromomethyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65481998 |
| Molecular Formula | C13H15BrN2O2S2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 4-(bromomethyl)-N-methyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ncc(CN(C)S(=O)(=O)c2ccc(CBr)cc2)s1 |
| InChI | InChI=1S/C13H15BrN2O2S2/c1-10-15-8-12(19-10)9-16(2)20(17,18)13-5-3-11(7-14)4-6-13/h3-6,8H,7,9H2,1-2H3 |
| InChIKey | ZBKPKYBMGZWQTN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|