C19H18F4O7S — CID 6549485
ethyl (1R,12R,14S)-1-hydroxy-3,9-dimethoxy-12-(1,1,2,2-tetrafluoroethyl)-7,11-dioxa-13-thiatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),5,9-tetraene-14-carboxylate (PubChem CID 6549485) has the molecular formula C19H18F4O7S and a molecular weight of 466.41 g/mol. Its IUPAC name is ethyl (1R,12R,14S)-1-hydroxy-3,9-dimethoxy-12-(1,1,2,2-tetrafluoroethyl)-7,11-dioxa-13-thiatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),5,9-tetraene-14-carboxylate.
| Compound Name | ethyl (1R,12R,14S)-1-hydroxy-3,9-dimethoxy-12-(1,1,2,2-tetrafluoroethyl)-7,11-dioxa-13-thiatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),5,9-tetraene-14-carboxylate |
|---|---|
| PubChem CID | 6549485 |
| Molecular Formula | C19H18F4O7S |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | ethyl (1R,12R,14S)-1-hydroxy-3,9-dimethoxy-12-(1,1,2,2-tetrafluoroethyl)-7,11-dioxa-13-thiatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),5,9-tetraene-14-carboxylate |
| SMILES | CCOC(=O)[C@H]1S[C@@]2(C(F)(F)C(F)F)C[C@@]1(O)c1c(c(OC)c3occc3c1OC)O2 |
| InChI | InChI=1S/C19H18F4O7S/c1-4-28-15(24)14-17(25)7-18(31-14,19(22,23)16(20)21)30-12-9(17)10(26-2)8-5-6-29-11(8)13(12)27-3/h5-6,14,16,25H,4,7H2,1-3H3/t14-,17-,18-/m1/s1 |
| InChIKey | HSTSJRSSHFKGQN-ZTFGCOKTSA-N |
| XLogP | 3.70 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|