C16H19N3S — CID 65497760
2-[1-[(6-amino-4-ethylsulfanylindol-1-yl)methyl]cyclopropyl]acetonitrile (PubChem CID 65497760) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 2-[1-[(6-amino-4-ethylsulfanylindol-1-yl)methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(6-amino-4-ethylsulfanylindol-1-yl)methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 65497760 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[1-[(6-amino-4-ethylsulfanylindol-1-yl)methyl]cyclopropyl]acetonitrile |
| SMILES | CCSc1cc(N)cc2c1ccn2CC1(CC#N)CC1 |
| InChI | InChI=1S/C16H19N3S/c1-2-20-15-10-12(18)9-14-13(15)3-8-19(14)11-16(4-5-16)6-7-17/h3,8-10H,2,4-6,11,18H2,1H3 |
| InChIKey | JOSILTVGYODKFP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|