C20H36N2O4S — CID 6553571
1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methylmethanesulfonamide (PubChem CID 6553571) has the molecular formula C20H36N2O4S and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methylmethanesulfonamide.
| Compound Name | 1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 6553571 |
| Molecular Formula | C20H36N2O4S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methylmethanesulfonamide |
| SMILES | CN(C1CC(C)(C)N(O)C(C)(C)C1)S(=O)(=O)C[C@@]12CC[C@@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C20H36N2O4S/c1-17(2)11-15(12-18(3,4)22(17)24)21(7)27(25,26)13-20-9-8-14(10-16(20)23)19(20,5)6/h14-15,24H,8-13H2,1-7H3/t14-,20-/m0/s1 |
| InChIKey | HZMFYJNISHUYQN-XOBRGWDASA-N |
| XLogP | 3.05 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |