About propanamide
propanamide (PubChem CID 6578) has the molecular formula C3H7NO
and a molecular weight of 73.09 g/mol. Its IUPAC name is propanamide.
Molecular Properties
| Compound Name | propanamide |
| PubChem CID | 6578 |
| Molecular Formula | C3H7NO |
| Molecular Weight | 73.09 g/mol |
| Exact Mass | 73.05 |
| IUPAC Name | propanamide |
| SMILES | CCC(N)=O |
| InChI | InChI=1S/C3H7NO/c1-2-3(4)5/h2H2,1H3,(H2,4,5) |
| InChIKey | QLNJFJADRCOGBJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.09 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide?
The IUPAC name of propanamide (CID 6578) is propanamide.
What is the SMILES notation for propanamide?
The canonical SMILES for propanamide is CCC(N)=O.
What is the InChIKey of propanamide?
The InChIKey is QLNJFJADRCOGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO/c1-2-3(4)5/h2H2,1H3,(H2,4,5).
What are the key properties of propanamide?
propanamide has a molecular weight of 73.09 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide is sourced from PubChem (CID 6578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).