C24H26N2O4 — CID 658694
N,1-dibenzyl-4-(1-hydroxycyclopentyl)-2,5-dioxopyrrolidine-3-carboxamide (PubChem CID 658694) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N,1-dibenzyl-4-(1-hydroxycyclopentyl)-2,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N,1-dibenzyl-4-(1-hydroxycyclopentyl)-2,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 658694 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N,1-dibenzyl-4-(1-hydroxycyclopentyl)-2,5-dioxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1C(=O)N(Cc2ccccc2)C(=O)C1C1(O)CCCC1 |
| InChI | InChI=1S/C24H26N2O4/c27-21(25-15-17-9-3-1-4-10-17)19-20(24(30)13-7-8-14-24)23(29)26(22(19)28)16-18-11-5-2-6-12-18/h1-6,9-12,19-20,30H,7-8,13-16H2,(H,25,27) |
| InChIKey | AZLBELZNTLQDJJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|