C8H11N3O — CID 66008656
5-amino-2-butan-2-yl-1,3-oxazole-4-carbonitrile (PubChem CID 66008656) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-amino-2-butan-2-yl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-amino-2-butan-2-yl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 66008656 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 5-amino-2-butan-2-yl-1,3-oxazole-4-carbonitrile |
| SMILES | CCC(C)c1nc(C#N)c(N)o1 |
| InChI | InChI=1S/C8H11N3O/c1-3-5(2)8-11-6(4-9)7(10)12-8/h5H,3,10H2,1-2H3 |
| InChIKey | URYXIOJMEYQFIU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |