C19H12N8 — CID 162729495
5-butan-2-yl-10-methylpyrazino[2,3-g]quinoxaline-2,3,7,8-tetracarbonitrile (PubChem CID 162729495) has the molecular formula C19H12N8 and a molecular weight of 352.36 g/mol. Its IUPAC name is 5-butan-2-yl-10-methylpyrazino[2,3-g]quinoxaline-2,3,7,8-tetracarbonitrile.
| Compound Name | 5-butan-2-yl-10-methylpyrazino[2,3-g]quinoxaline-2,3,7,8-tetracarbonitrile |
|---|---|
| PubChem CID | 162729495 |
| Molecular Formula | C19H12N8 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 5-butan-2-yl-10-methylpyrazino[2,3-g]quinoxaline-2,3,7,8-tetracarbonitrile |
| SMILES | CCC(C)c1c2nc(C#N)c(C#N)nc2c(C)c2nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C19H12N8/c1-4-9(2)15-18-16(24-11(5-20)13(7-22)26-18)10(3)17-19(15)27-14(8-23)12(6-21)25-17/h9H,4H2,1-3H3 |
| InChIKey | CZDRZBRWLYZEJT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 146.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|