About 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile
5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile (PubChem CID 66009070) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 66009070 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(C2CCCCCCC2)oc1N |
| InChI | InChI=1S/C12H17N3O/c13-8-10-11(14)16-12(15-10)9-6-4-2-1-3-5-7-9/h9H,1-7,14H2 |
| InChIKey | YHFGMYPVASKUKP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile (CID 66009070) is 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile is N#Cc1nc(C2CCCCCCC2)oc1N.
What is the InChIKey of 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile?
The InChIKey is YHFGMYPVASKUKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c13-8-10-11(14)16-12(15-10)9-6-4-2-1-3-5-7-9/h9H,1-7,14H2.
What are the key properties of 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile?
5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile has a molecular weight of 219.29 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-cyclooctyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 66009070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).