C12H22N4O2 — CID 66016266
1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-3,3-dimethylbutan-2-amine (PubChem CID 66016266) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-3,3-dimethylbutan-2-amine.
| Compound Name | 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 66016266 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-3,3-dimethylbutan-2-amine |
| SMILES | CCc1nn(C)c(CC(N)C(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H22N4O2/c1-6-8-11(16(17)18)9(15(5)14-8)7-10(13)12(2,3)4/h10H,6-7,13H2,1-5H3 |
| InChIKey | UZFVPNVHOADTQK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|