C10H14N2O4S — CID 66030110
3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 66030110) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66030110 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-[(2-oxo-1,3-thiazolidine-4-carbonyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C1NC(C(=O)NC2CCC(C(=O)O)C2)CS1 |
| InChI | InChI=1S/C10H14N2O4S/c13-8(7-4-17-10(16)12-7)11-6-2-1-5(3-6)9(14)15/h5-7H,1-4H2,(H,11,13)(H,12,16)(H,14,15) |
| InChIKey | RJBCFVPWPWXBCZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|