C23H32N6 — CID 6605088
N-cyclohexyl-9-[3-(dimethylamino)propyl]-2-methyl-8-phenylpurin-6-amine (PubChem CID 6605088) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-cyclohexyl-9-[3-(dimethylamino)propyl]-2-methyl-8-phenylpurin-6-amine.
| Compound Name | N-cyclohexyl-9-[3-(dimethylamino)propyl]-2-methyl-8-phenylpurin-6-amine |
|---|---|
| PubChem CID | 6605088 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-cyclohexyl-9-[3-(dimethylamino)propyl]-2-methyl-8-phenylpurin-6-amine |
| SMILES | Cc1nc(NC2CCCCC2)c2nc(-c3ccccc3)n(CCCN(C)C)c2n1 |
| InChI | InChI=1S/C23H32N6/c1-17-24-21(26-19-13-8-5-9-14-19)20-23(25-17)29(16-10-15-28(2)3)22(27-20)18-11-6-4-7-12-18/h4,6-7,11-12,19H,5,8-10,13-16H2,1-3H3,(H,24,25,26) |
| InChIKey | MZTDJPHGYJKXKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |