C13H18N2O5 — CID 66062486
1-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 66062486) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66062486 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)CC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C13H18N2O5/c1-8-11(18)14-9(16)7-15(8)10(17)6-13(12(19)20)4-2-3-5-13/h8H,2-7H2,1H3,(H,19,20)(H,14,16,18) |
| InChIKey | JQTJZTKPSYEPQC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|