C9H11N3O3S — CID 66060818
2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]sulfanylacetonitrile (PubChem CID 66060818) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]sulfanylacetonitrile.
| Compound Name | 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 66060818 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]sulfanylacetonitrile |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)CSCC#N |
| InChI | InChI=1S/C9H11N3O3S/c1-6-9(15)11-7(13)4-12(6)8(14)5-16-3-2-10/h6H,3-5H2,1H3,(H,11,13,15) |
| InChIKey | ABTONLARUDFQNR-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|