C10H13N3O7 — CID 66074682
2-[carboxymethyl-(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]acetic acid (PubChem CID 66074682) has the molecular formula C10H13N3O7 and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-[carboxymethyl-(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl-(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 66074682 |
| Molecular Formula | C10H13N3O7 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[carboxymethyl-(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]acetic acid |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H13N3O7/c1-5-9(19)11-6(14)2-13(5)10(20)12(3-7(15)16)4-8(17)18/h5H,2-4H2,1H3,(H,15,16)(H,17,18)(H,11,14,19) |
| InChIKey | XKVACZUMXHSTTF-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|