C29H42N2O5 — CID 6606986
[(2S)-1-[(2R)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl (2R)-2-benzylhept-6-enoate (PubChem CID 6606986) has the molecular formula C29H42N2O5 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(2S)-1-[(2R)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl (2R)-2-benzylhept-6-enoate.
| Compound Name | [(2S)-1-[(2R)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl (2R)-2-benzylhept-6-enoate |
|---|---|
| PubChem CID | 6606986 |
| Molecular Formula | C29H42N2O5 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | [(2S)-1-[(2R)-2-[2-[[(2S)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]pent-4-enoyl]pyrrolidin-2-yl]methyl (2R)-2-benzylhept-6-enoate |
| SMILES | C=CCCC[C@H](Cc1ccccc1)C(=O)OC[C@@H]1CCCN1C(=O)[C@H](CC=C)CC(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C29H42N2O5/c1-4-6-8-15-25(18-23-13-9-7-10-14-23)29(35)36-21-26-16-11-17-31(26)28(34)24(12-5-2)19-27(33)30-22(3)20-32/h4-5,7,9-10,13-14,22,24-26,32H,1-2,6,8,11-12,15-21H2,3H3,(H,30,33)/t22-,24+,25+,26-/m0/s1 |
| InChIKey | UKRUOHJAKMRCHY-CDCCBSOTSA-N |
| XLogP | 3.82 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|