C12H13N3O4S2 — CID 66085587
3-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzenecarbothioamide (PubChem CID 66085587) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 3-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzenecarbothioamide.
| Compound Name | 3-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 66085587 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-[(3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CS(=O)(=O)N2CC(=O)NC(=O)C2)c1 |
| InChI | InChI=1S/C12H13N3O4S2/c13-12(20)9-3-1-2-8(4-9)7-21(18,19)15-5-10(16)14-11(17)6-15/h1-4H,5-7H2,(H2,13,20)(H,14,16,17) |
| InChIKey | WJNWDMYWXTWVPY-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|