C15H22N2O3 — CID 6611126
3-[2-[1-(1-adamantyl)ethylidene]hydrazinyl]-3-oxopropanoic acid (PubChem CID 6611126) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-[2-[1-(1-adamantyl)ethylidene]hydrazinyl]-3-oxopropanoic acid.
| Compound Name | 3-[2-[1-(1-adamantyl)ethylidene]hydrazinyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 6611126 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-[2-[1-(1-adamantyl)ethylidene]hydrazinyl]-3-oxopropanoic acid |
| SMILES | CC(=NNC(=O)CC(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H22N2O3/c1-9(16-17-13(18)5-14(19)20)15-6-10-2-11(7-15)4-12(3-10)8-15/h10-12H,2-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | ZYFJIKCNYRCRQV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|