C10H12FNO4S2 — CID 66115046
3-(2-fluoro-4-sulfamoylphenyl)sulfanylbutanoic acid (PubChem CID 66115046) has the molecular formula C10H12FNO4S2 and a molecular weight of 293.34 g/mol. Its IUPAC name is 3-(2-fluoro-4-sulfamoylphenyl)sulfanylbutanoic acid.
| Compound Name | 3-(2-fluoro-4-sulfamoylphenyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 66115046 |
| Molecular Formula | C10H12FNO4S2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-(2-fluoro-4-sulfamoylphenyl)sulfanylbutanoic acid |
| SMILES | CC(CC(=O)O)Sc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H12FNO4S2/c1-6(4-10(13)14)17-9-3-2-7(5-8(9)11)18(12,15)16/h2-3,5-6H,4H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | ITNUXFMVEWOQAF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |