C9H6F2N2O — CID 66201491
4-(3,5-difluorophenyl)-1,2-oxazol-3-amine (PubChem CID 66201491) has the molecular formula C9H6F2N2O and a molecular weight of 196.16 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(3,5-difluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66201491 |
| Molecular Formula | C9H6F2N2O |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 4-(3,5-difluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1nocc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H6F2N2O/c10-6-1-5(2-7(11)3-6)8-4-14-13-9(8)12/h1-4H,(H2,12,13) |
| InChIKey | VSWRNUFGKCJDFM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |