C12H21N3O — CID 66208843
1-methyl-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrrolidin-2-one (PubChem CID 66208843) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrrolidin-2-one.
| Compound Name | 1-methyl-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 66208843 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-methyl-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)pyrrolidin-2-one |
| SMILES | CC1C2CNCC2CN1C1CCN(C)C1=O |
| InChI | InChI=1S/C12H21N3O/c1-8-10-6-13-5-9(10)7-15(8)11-3-4-14(2)12(11)16/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | GHYVKURHGXVXPY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |