C16H21FN2 — CID 83069875
5-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 83069875) has the molecular formula C16H21FN2 and a molecular weight of 260.36 g/mol. Its IUPAC name is 5-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 83069875 |
| Molecular Formula | C16H21FN2 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 5-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1C1CCc2c(F)cccc21 |
| InChI | InChI=1S/C16H21FN2/c1-10-14-8-18-7-11(14)9-19(10)16-6-5-12-13(16)3-2-4-15(12)17/h2-4,10-11,14,16,18H,5-9H2,1H3 |
| InChIKey | GRNLLHGKMWDCHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |