About 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine
5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine (PubChem CID 66229931) has the molecular formula C19H21NS
and a molecular weight of 295.45 g/mol. Its IUPAC name is 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine |
| PubChem CID | 66229931 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine |
| SMILES | CC1(C)CSCC(c2ccc3c(c2)Cc2ccccc2-3)N1 |
| InChI | InChI=1S/C19H21NS/c1-19(2)12-21-11-18(20-19)14-7-8-17-15(10-14)9-13-5-3-4-6-16(13)17/h3-8,10,18,20H,9,11-12H2,1-2H3 |
| InChIKey | GLPJDCYXHZEIRB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine?
The IUPAC name of 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine (CID 66229931) is 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine.
What is the SMILES notation for 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine?
The canonical SMILES for 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine is CC1(C)CSCC(c2ccc3c(c2)Cc2ccccc2-3)N1.
What is the InChIKey of 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine?
The InChIKey is GLPJDCYXHZEIRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NS/c1-19(2)12-21-11-18(20-19)14-7-8-17-15(10-14)9-13-5-3-4-6-16(13)17/h3-8,10,18,20H,9,11-12H2,1-2H3.
What are the key properties of 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine?
5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine has a molecular weight of 295.45 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine is sourced from PubChem (CID 66229931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).