C19H21NS — CID 66229931
5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine (PubChem CID 66229931) has the molecular formula C19H21NS and a molecular weight of 295.45 g/mol. Its IUPAC name is 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine.
| Compound Name | 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 66229931 |
| Molecular Formula | C19H21NS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-(9H-fluoren-2-yl)-3,3-dimethylthiomorpholine |
| SMILES | CC1(C)CSCC(c2ccc3c(c2)Cc2ccccc2-3)N1 |
| InChI | InChI=1S/C19H21NS/c1-19(2)12-21-11-18(20-19)14-7-8-17-15(10-14)9-13-5-3-4-6-16(13)17/h3-8,10,18,20H,9,11-12H2,1-2H3 |
| InChIKey | GLPJDCYXHZEIRB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |