C22H26 — CID 145257374
1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]fluorene (PubChem CID 145257374) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]fluorene.
| Compound Name | 1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]fluorene |
|---|---|
| PubChem CID | 145257374 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]fluorene |
| SMILES | CC1(C)c2cc3c(cc2C(C)(C)C1(C)C)-c1ccccc1C3 |
| InChI | InChI=1S/C22H26/c1-20(2)18-12-15-11-14-9-7-8-10-16(14)17(15)13-19(18)21(3,4)22(20,5)6/h7-10,12-13H,11H2,1-6H3 |
| InChIKey | YRLAWHDOFDXXNN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |