C20H20FN3O3S — CID 6623969
5-(4-fluorophenyl)-2-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrrole-3-carboxamide (PubChem CID 6623969) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 6623969 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(-c2ccc(F)cc2)cc1C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20FN3O3S/c1-13-18(12-19(24-13)15-4-6-16(21)7-5-15)20(25)23-11-10-14-2-8-17(9-3-14)28(22,26)27/h2-9,12,24H,10-11H2,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | JLDXQLGVTCVDEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |