C14H27N3O2S — CID 66241703
4,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66241703) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 4,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66241703 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 4,4-dimethyl-5-(4-methylpiperidin-1-yl)sulfonyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC1CCN(S(=O)(=O)N2CC3CNCC3C2(C)C)CC1 |
| InChI | InChI=1S/C14H27N3O2S/c1-11-4-6-16(7-5-11)20(18,19)17-10-12-8-15-9-13(12)14(17,2)3/h11-13,15H,4-10H2,1-3H3 |
| InChIKey | HBZMRJHSLKKVFG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |