C11H20N2O4S — CID 66243354
3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]propanoic acid (PubChem CID 66243354) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]propanoic acid.
| Compound Name | 3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]propanoic acid |
|---|---|
| PubChem CID | 66243354 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]propanoic acid |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H20N2O4S/c1-11(2)9-6-12-5-8(9)7-13(11)18(16,17)4-3-10(14)15/h8-9,12H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | LYGVSTMZYDKFLQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |