C12H18N4O4S — CID 66242542
5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]-1H-pyrimidine-2,4-dione (PubChem CID 66242542) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66242542 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-[(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)sulfonyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC1(C)C2CNCC2CN1S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H18N4O4S/c1-12(2)8-4-13-3-7(8)6-16(12)21(19,20)9-5-14-11(18)15-10(9)17/h5,7-8,13H,3-4,6H2,1-2H3,(H2,14,15,17,18) |
| InChIKey | SNUNDXPBRPVOMB-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |