C10H16IN3 — CID 66306098
5-iodo-6-methyl-2-(3-methylbutyl)pyrimidin-4-amine (PubChem CID 66306098) has the molecular formula C10H16IN3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 5-iodo-6-methyl-2-(3-methylbutyl)pyrimidin-4-amine.
| Compound Name | 5-iodo-6-methyl-2-(3-methylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66306098 |
| Molecular Formula | C10H16IN3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 5-iodo-6-methyl-2-(3-methylbutyl)pyrimidin-4-amine |
| SMILES | Cc1nc(CCC(C)C)nc(N)c1I |
| InChI | InChI=1S/C10H16IN3/c1-6(2)4-5-8-13-7(3)9(11)10(12)14-8/h6H,4-5H2,1-3H3,(H2,12,13,14) |
| InChIKey | SNHQXYXHDHSUTC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|