C14H25N3 — CID 90724763
2-(3-methylbutyl)-4,6-di(propan-2-yl)-1,3,5-triazine (PubChem CID 90724763) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-(3-methylbutyl)-4,6-di(propan-2-yl)-1,3,5-triazine.
| Compound Name | 2-(3-methylbutyl)-4,6-di(propan-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90724763 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-(3-methylbutyl)-4,6-di(propan-2-yl)-1,3,5-triazine |
| SMILES | CC(C)CCc1nc(C(C)C)nc(C(C)C)n1 |
| InChI | InChI=1S/C14H25N3/c1-9(2)7-8-12-15-13(10(3)4)17-14(16-12)11(5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | HGEQBTGATHFKIW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |